C42H50N4O2S+2 — CID 77105898
3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium (PubChem CID 77105898) has the molecular formula C42H50N4O2S+2 and a molecular weight of 674.96 g/mol. Its IUPAC name is 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium.
| Compound Name | 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 77105898 |
| Molecular Formula | C42H50N4O2S+2 |
| Molecular Weight | 674.96 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium |
| SMILES | CCCCN(CCC[N+](C)(C)Cc1cccc(OC)c1)c1cc(/C=C2\Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C42H50N4O2S/c1-7-8-24-44(25-15-26-46(3,4)31-32-16-14-19-35(27-32)47-5)41-28-33(29-42-43(2)38-20-12-13-21-40(38)49-42)37-23-22-36(48-6)30-39(37)45(41)34-17-10-9-11-18-34/h9-14,16-23,27-30H,7-8,15,24-26,31H2,1-6H3/q+2 |
| InChIKey | VGHJWPZOARHPFD-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 28.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.96 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|