C10H12N2O5 — CID 77106170
2-(3,4-dimethyl-6-oxopyridazin-1-yl)butanedioic acid (PubChem CID 77106170) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-(3,4-dimethyl-6-oxopyridazin-1-yl)butanedioic acid.
| Compound Name | 2-(3,4-dimethyl-6-oxopyridazin-1-yl)butanedioic acid |
|---|---|
| PubChem CID | 77106170 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(3,4-dimethyl-6-oxopyridazin-1-yl)butanedioic acid |
| SMILES | Cc1cc(=O)n(C(CC(=O)O)C(=O)O)nc1C |
| InChI | InChI=1S/C10H12N2O5/c1-5-3-8(13)12(11-6(5)2)7(10(16)17)4-9(14)15/h3,7H,4H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | KYAPUXKNKKHRJH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |