C15H25N3O3 — CID 175588053
2-[3-[2-(dimethylamino)ethyl]-4-methyl-6-oxopyridazin-1-yl]-4-methylpentanoic acid (PubChem CID 175588053) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethyl]-4-methyl-6-oxopyridazin-1-yl]-4-methylpentanoic acid.
| Compound Name | 2-[3-[2-(dimethylamino)ethyl]-4-methyl-6-oxopyridazin-1-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175588053 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[3-[2-(dimethylamino)ethyl]-4-methyl-6-oxopyridazin-1-yl]-4-methylpentanoic acid |
| SMILES | Cc1cc(=O)n(C(CC(C)C)C(=O)O)nc1CCN(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-10(2)8-13(15(20)21)18-14(19)9-11(3)12(16-18)6-7-17(4)5/h9-10,13H,6-8H2,1-5H3,(H,20,21) |
| InChIKey | BTXONDNFDMGCNH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |