C15H25N3O3 — CID 168984621
methyl (2S)-2-[3-[2-(dimethylamino)ethyl]-6-oxopyridazin-1-yl]-4-methylpentanoate (PubChem CID 168984621) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl (2S)-2-[3-[2-(dimethylamino)ethyl]-6-oxopyridazin-1-yl]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[3-[2-(dimethylamino)ethyl]-6-oxopyridazin-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 168984621 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | methyl (2S)-2-[3-[2-(dimethylamino)ethyl]-6-oxopyridazin-1-yl]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)n1nc(CCN(C)C)ccc1=O |
| InChI | InChI=1S/C15H25N3O3/c1-11(2)10-13(15(20)21-5)18-14(19)7-6-12(16-18)8-9-17(3)4/h6-7,11,13H,8-10H2,1-5H3/t13-/m0/s1 |
| InChIKey | VROBTLITXNFZQC-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |