C8H15N5O2 — CID 71606975
methyl (2S)-2-(5-aminotetrazol-1-yl)-4-methylpentanoate (PubChem CID 71606975) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is methyl (2S)-2-(5-aminotetrazol-1-yl)-4-methylpentanoate.
| Compound Name | methyl (2S)-2-(5-aminotetrazol-1-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 71606975 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | methyl (2S)-2-(5-aminotetrazol-1-yl)-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)n1nnnc1N |
| InChI | InChI=1S/C8H15N5O2/c1-5(2)4-6(7(14)15-3)13-8(9)10-11-12-13/h5-6H,4H2,1-3H3,(H2,9,10,12)/t6-/m0/s1 |
| InChIKey | OATGCBIEPYRCFO-LURJTMIESA-N |
| XLogP | 0.02 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |