C8H13N5O3 — CID 79317682
ethyl 1-[1-(methylamino)-1-oxopropan-2-yl]tetrazole-5-carboxylate (PubChem CID 79317682) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is ethyl 1-[1-(methylamino)-1-oxopropan-2-yl]tetrazole-5-carboxylate.
| Compound Name | ethyl 1-[1-(methylamino)-1-oxopropan-2-yl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79317682 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | ethyl 1-[1-(methylamino)-1-oxopropan-2-yl]tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1C(C)C(=O)NC |
| InChI | InChI=1S/C8H13N5O3/c1-4-16-8(15)6-10-11-12-13(6)5(2)7(14)9-3/h5H,4H2,1-3H3,(H,9,14) |
| InChIKey | RGJOHUPYLOISCE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |