C11H19N5O3 — CID 79317843
ethyl 1-[2-oxo-2-(pentan-2-ylamino)ethyl]tetrazole-5-carboxylate (PubChem CID 79317843) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(pentan-2-ylamino)ethyl]tetrazole-5-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(pentan-2-ylamino)ethyl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79317843 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | ethyl 1-[2-oxo-2-(pentan-2-ylamino)ethyl]tetrazole-5-carboxylate |
| SMILES | CCCC(C)NC(=O)Cn1nnnc1C(=O)OCC |
| InChI | InChI=1S/C11H19N5O3/c1-4-6-8(3)12-9(17)7-16-10(13-14-15-16)11(18)19-5-2/h8H,4-7H2,1-3H3,(H,12,17) |
| InChIKey | CIGHHTZHNJSCSU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |