C12H12IN5O3 — CID 79309343
ethyl 1-[2-(2-iodoanilino)-2-oxoethyl]tetrazole-5-carboxylate (PubChem CID 79309343) has the molecular formula C12H12IN5O3 and a molecular weight of 401.16 g/mol. Its IUPAC name is ethyl 1-[2-(2-iodoanilino)-2-oxoethyl]tetrazole-5-carboxylate.
| Compound Name | ethyl 1-[2-(2-iodoanilino)-2-oxoethyl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79309343 |
| Molecular Formula | C12H12IN5O3 |
| Molecular Weight | 401.16 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | ethyl 1-[2-(2-iodoanilino)-2-oxoethyl]tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1CC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C12H12IN5O3/c1-2-21-12(20)11-15-16-17-18(11)7-10(19)14-9-6-4-3-5-8(9)13/h3-6H,2,7H2,1H3,(H,14,19) |
| InChIKey | ZWEVJARHEYAXPR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|