C15H15N5O3 — CID 94942232
ethyl 2-[[2-(4-cyano-5-methyltriazol-1-yl)acetyl]amino]benzoate (PubChem CID 94942232) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is ethyl 2-[[2-(4-cyano-5-methyltriazol-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(4-cyano-5-methyltriazol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 94942232 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 2-[[2-(4-cyano-5-methyltriazol-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cn1nnc(C#N)c1C |
| InChI | InChI=1S/C15H15N5O3/c1-3-23-15(22)11-6-4-5-7-12(11)17-14(21)9-20-10(2)13(8-16)18-19-20/h4-7H,3,9H2,1-2H3,(H,17,21) |
| InChIKey | HNUQTFYUTSTCJY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |