C20H20F6N4O2S — CID 77106738
ethyl 7-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butanethioyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate (PubChem CID 77106738) has the molecular formula C20H20F6N4O2S and a molecular weight of 494.46 g/mol. Its IUPAC name is ethyl 7-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butanethioyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate.
| Compound Name | ethyl 7-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butanethioyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 77106738 |
| Molecular Formula | C20H20F6N4O2S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | ethyl 7-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butanethioyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)n2c1CN(C(=S)C[C@@H](N)Cc1cc(F)c(F)cc1F)CC2 |
| InChI | InChI=1S/C20H20F6N4O2S/c1-2-32-18(31)17-15-9-29(3-4-30(15)19(28-17)20(24,25)26)16(33)7-11(27)5-10-6-13(22)14(23)8-12(10)21/h6,8,11H,2-5,7,9,27H2,1H3/t11-/m0/s1 |
| InChIKey | IEMJHTMXBRKLNP-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|