C18H17F6N4O6P — CID 140615318
phosphono 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate (PubChem CID 140615318) has the molecular formula C18H17F6N4O6P and a molecular weight of 530.32 g/mol. Its IUPAC name is phosphono 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate.
| Compound Name | phosphono 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 140615318 |
| Molecular Formula | C18H17F6N4O6P |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | phosphono 7-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxylate |
| SMILES | N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(C(=O)OP(=O)(O)O)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H17F6N4O6P/c19-10-6-12(21)11(20)4-8(10)3-9(25)5-14(29)27-1-2-28-13(7-27)15(16(30)34-35(31,32)33)26-17(28)18(22,23)24/h4,6,9H,1-3,5,7,25H2,(H2,31,32,33)/t9-/m1/s1 |
| InChIKey | DIDWVIAFVGWGBG-SECBINFHSA-N |
| XLogP | 1.87 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|