C18H17F6N5O2 — CID 75038466
N-[7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]formamide (PubChem CID 75038466) has the molecular formula C18H17F6N5O2 and a molecular weight of 449.36 g/mol. Its IUPAC name is N-[7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]formamide.
| Compound Name | N-[7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]formamide |
|---|---|
| PubChem CID | 75038466 |
| Molecular Formula | C18H17F6N5O2 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]formamide |
| SMILES | NC(CC(=O)N1CCn2c(C(F)(F)F)nc(NC=O)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H17F6N5O2/c19-11-6-13(21)12(20)4-9(11)3-10(25)5-15(31)28-1-2-29-14(7-28)16(26-8-30)27-17(29)18(22,23)24/h4,6,8,10H,1-3,5,7,25H2,(H,26,30) |
| InChIKey | KNKRHXSCRHFMQQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|