C25H18F12N4O — CID 44516184
(3R)-3-amino-1-[1-[2,4-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 44516184) has the molecular formula C25H18F12N4O and a molecular weight of 618.42 g/mol. Its IUPAC name is (3R)-3-amino-1-[1-[2,4-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[1-[2,4-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 44516184 |
| Molecular Formula | C25H18F12N4O |
| Molecular Weight | 618.42 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | (3R)-3-amino-1-[1-[2,4-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H18F12N4O/c26-16-9-18(28)17(27)6-11(16)5-13(38)8-20(42)40-3-4-41-19(10-40)21(39-22(41)25(35,36)37)14-2-1-12(23(29,30)31)7-15(14)24(32,33)34/h1-2,6-7,9,13H,3-5,8,10,38H2/t13-/m1/s1 |
| InChIKey | XTCCVZWUFPJJDK-CYBMUJFWSA-N |
| XLogP | 6.33 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|