C10H20N2O — CID 77110360
N'-cyclopropyl-N'-(2-methoxyethyl)but-2-ene-1,4-diamine (PubChem CID 77110360) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N'-cyclopropyl-N'-(2-methoxyethyl)but-2-ene-1,4-diamine.
| Compound Name | N'-cyclopropyl-N'-(2-methoxyethyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110360 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N'-cyclopropyl-N'-(2-methoxyethyl)but-2-ene-1,4-diamine |
| SMILES | COCCN(CC=CCN)C1CC1 |
| InChI | InChI=1S/C10H20N2O/c1-13-9-8-12(10-4-5-10)7-3-2-6-11/h2-3,10H,4-9,11H2,1H3 |
| InChIKey | CLRMNOAMPLZLII-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|