C13H20N2O — CID 77110782
N'-[(3-methoxyphenyl)methyl]-N'-methylbut-2-ene-1,4-diamine (PubChem CID 77110782) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N'-[(3-methoxyphenyl)methyl]-N'-methylbut-2-ene-1,4-diamine.
| Compound Name | N'-[(3-methoxyphenyl)methyl]-N'-methylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110782 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N'-[(3-methoxyphenyl)methyl]-N'-methylbut-2-ene-1,4-diamine |
| SMILES | COc1cccc(CN(C)CC=CCN)c1 |
| InChI | InChI=1S/C13H20N2O/c1-15(9-4-3-8-14)11-12-6-5-7-13(10-12)16-2/h3-7,10H,8-9,11,14H2,1-2H3 |
| InChIKey | SGNBKQUTQXAVKZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|