C11H17N3 — CID 77110305
N'-methyl-N'-(pyridin-3-ylmethyl)but-2-ene-1,4-diamine (PubChem CID 77110305) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N'-methyl-N'-(pyridin-3-ylmethyl)but-2-ene-1,4-diamine.
| Compound Name | N'-methyl-N'-(pyridin-3-ylmethyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110305 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N'-methyl-N'-(pyridin-3-ylmethyl)but-2-ene-1,4-diamine |
| SMILES | CN(CC=CCN)Cc1cccnc1 |
| InChI | InChI=1S/C11H17N3/c1-14(8-3-2-6-12)10-11-5-4-7-13-9-11/h2-5,7,9H,6,8,10,12H2,1H3 |
| InChIKey | ORCBDEZEGCMSKA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|