C10H17N3S — CID 77110787
N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]but-2-ene-1,4-diamine (PubChem CID 77110787) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]but-2-ene-1,4-diamine.
| Compound Name | N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 77110787 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]but-2-ene-1,4-diamine |
| SMILES | Cc1nc(CN(C)CC=CCN)cs1 |
| InChI | InChI=1S/C10H17N3S/c1-9-12-10(8-14-9)7-13(2)6-4-3-5-11/h3-4,8H,5-7,11H2,1-2H3 |
| InChIKey | XQDJMKGODSTZLU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|