C7H11BF3KN2S — CID 63704903
potassium trifluoro-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methyl]boranuide (PubChem CID 63704903) has the molecular formula C7H11BF3KN2S and a molecular weight of 262.15 g/mol. Its IUPAC name is potassium trifluoro-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methyl]boranuide.
| Compound Name | potassium trifluoro-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methyl]boranuide |
|---|---|
| PubChem CID | 63704903 |
| Molecular Formula | C7H11BF3KN2S |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | potassium trifluoro-[[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]methyl]boranuide |
| SMILES | Cc1nc(CN(C)C[B-](F)(F)F)cs1.[K+] |
| InChI | InChI=1S/C7H11BF3N2S.K/c1-6-12-7(4-14-6)3-13(2)5-8(9,10)11;/h4H,3,5H2,1-2H3;/q-1;+1 |
| InChIKey | WRWGLPSQGLQIFC-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|