C11H19N3S — CID 103070174
N,N'-dimethyl-2-methylidene-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 103070174) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N,N'-dimethyl-2-methylidene-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-2-methylidene-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103070174 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N,N'-dimethyl-2-methylidene-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | C=C(CNC)CN(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H19N3S/c1-9(5-12-3)6-14(4)7-11-8-15-10(2)13-11/h8,12H,1,5-7H2,2-4H3 |
| InChIKey | UQEGPEBNIIRBQQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|