C14H20N2O5 — CID 77110984
4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 77110984) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 77110984 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | CC(O)(CNC(=O)C(N)Cc1ccc(O)cc1)CC(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-14(21,7-12(18)19)8-16-13(20)11(15)6-9-2-4-10(17)5-3-9/h2-5,11,17,21H,6-8,15H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | AFJZIVWVLMBHKX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |