C12H12N2O4S — CID 77111388
3-[5-[(3,5-dioxopiperazin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 77111388) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-[5-[(3,5-dioxopiperazin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(3,5-dioxopiperazin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77111388 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[5-[(3,5-dioxopiperazin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(CN2CC(=O)NC(=O)C2)c1 |
| InChI | InChI=1S/C12H12N2O4S/c15-10-5-14(6-11(16)13-10)4-9-3-8(7-19-9)1-2-12(17)18/h1-3,7H,4-6H2,(H,17,18)(H,13,15,16) |
| InChIKey | VWHPNGAGOGVQDR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|