C18H21N2O5S2- — CID 7711202
5-[[(3aS,6aS)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoate (PubChem CID 7711202) has the molecular formula C18H21N2O5S2- and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-[[(3aS,6aS)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoate.
| Compound Name | 5-[[(3aS,6aS)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 7711202 |
| Molecular Formula | C18H21N2O5S2- |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5-[[(3aS,6aS)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoate |
| SMILES | O=C([O-])CCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1CCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O5S2/c21-16(7-4-8-17(22)23)19-18-20(10-9-13-5-2-1-3-6-13)14-11-27(24,25)12-15(14)26-18/h1-3,5-6,14-15H,4,7-12H2,(H,22,23)/p-1/b19-18-/t14-,15+/m0/s1 |
| InChIKey | KQNZITBDPAUWAA-VVWDJWGFSA-M |
| XLogP | 0.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|