C17H19N2O6S2- — CID 7711948
4-[[(3aR,6aS)-3-(2-methoxy-5-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoate (PubChem CID 7711948) has the molecular formula C17H19N2O6S2- and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-3-(2-methoxy-5-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoate.
| Compound Name | 4-[[(3aR,6aS)-3-(2-methoxy-5-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7711948 |
| Molecular Formula | C17H19N2O6S2- |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-[[(3aR,6aS)-3-(2-methoxy-5-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoate |
| SMILES | COc1ccc(C)cc1N1/C(=N/C(=O)CCC(=O)[O-])S[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H20N2O6S2/c1-10-3-4-13(25-2)11(7-10)19-12-8-27(23,24)9-14(12)26-17(19)18-15(20)5-6-16(21)22/h3-4,7,12,14H,5-6,8-9H2,1-2H3,(H,21,22)/p-1/b18-17-/t12-,14-/m1/s1 |
| InChIKey | IRLJJDBCLKVADP-RECGACTCSA-M |
| XLogP | 0.14 |
| TPSA | 116.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|