C12H17FN2O — CID 77130261
2-amino-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanol (PubChem CID 77130261) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-amino-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanol.
| Compound Name | 2-amino-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanol |
|---|---|
| PubChem CID | 77130261 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-amino-2-(3-fluoro-4-pyrrolidin-1-ylphenyl)ethanol |
| SMILES | NC(CO)c1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c13-10-7-9(11(14)8-16)3-4-12(10)15-5-1-2-6-15/h3-4,7,11,16H,1-2,5-6,8,14H2 |
| InChIKey | PVXLWVWMIVBPCK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |