C17H19FN6O3S — CID 77136616
3-[4-[1-[(2-amino-1,3-thiazol-4-yl)methyl]-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 77136616) has the molecular formula C17H19FN6O3S and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-[4-[1-[(2-amino-1,3-thiazol-4-yl)methyl]-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-[1-[(2-amino-1,3-thiazol-4-yl)methyl]-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 77136616 |
| Molecular Formula | C17H19FN6O3S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-[4-[1-[(2-amino-1,3-thiazol-4-yl)methyl]-5,6-dihydro-1,2,4-triazin-4-yl]-3-fluorophenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | Nc1nc(CN2CCN(c3ccc(N4CC(CO)OC4=O)cc3F)C=N2)cs1 |
| InChI | InChI=1S/C17H19FN6O3S/c18-14-5-12(24-7-13(8-25)27-17(24)26)1-2-15(14)22-3-4-23(20-10-22)6-11-9-28-16(19)21-11/h1-2,5,9-10,13,25H,3-4,6-8H2,(H2,19,21) |
| InChIKey | CCALXFBQKZGMID-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |