C25H32O13 — CID 77140105
2-[3-oxo-2-[4-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-2-yl]oxypent-2-enyl]cyclopentyl]acetic acid (PubChem CID 77140105) has the molecular formula C25H32O13 and a molecular weight of 540.52 g/mol. Its IUPAC name is 2-[3-oxo-2-[4-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-2-yl]oxypent-2-enyl]cyclopentyl]acetic acid.
| Compound Name | 2-[3-oxo-2-[4-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-2-yl]oxypent-2-enyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 77140105 |
| Molecular Formula | C25H32O13 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 2-[3-oxo-2-[4-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-2-yl]oxypent-2-enyl]cyclopentyl]acetic acid |
| SMILES | CC(C=CCC1C(=O)CCC1CC(=O)O)OC1OC(COC(=O)c2cc(O)c(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C25H32O13/c1-11(3-2-4-14-12(9-19(29)30)5-6-15(14)26)37-25-23(34)22(33)21(32)18(38-25)10-36-24(35)13-7-16(27)20(31)17(28)8-13/h2-3,7-8,11-12,14,18,21-23,25,27-28,31-34H,4-6,9-10H2,1H3,(H,29,30) |
| InChIKey | GVYRDMUQLHIZPL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 220.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|