C20H22O6S — CID 77142730
2-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 77142730) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 77142730 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-[4-(benzenesulfonyl)-3-methylbut-2-enyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CC=C(C)CS(=O)(=O)c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C20H22O6S/c1-13(12-27(23,24)15-8-6-5-7-9-15)10-11-16-14(2)17(21)19(25-3)20(26-4)18(16)22/h5-10H,11-12H2,1-4H3 |
| InChIKey | QXGLPKDTZVORED-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|