C16H20O3S — CID 134885361
5-(benzenesulfonyl)-2,7-dimethylocta-2,6-dien-4-one (PubChem CID 134885361) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2,7-dimethylocta-2,6-dien-4-one.
| Compound Name | 5-(benzenesulfonyl)-2,7-dimethylocta-2,6-dien-4-one |
|---|---|
| PubChem CID | 134885361 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(benzenesulfonyl)-2,7-dimethylocta-2,6-dien-4-one |
| SMILES | CC(C)=CC(=O)C(C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O3S/c1-12(2)10-15(17)16(11-13(3)4)20(18,19)14-8-6-5-7-9-14/h5-11,16H,1-4H3 |
| InChIKey | YQOBFMNCJYLMQW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|