C15H12N2O3S2 — CID 7715964
[(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 7715964) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 7715964 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccsc1)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C15H12N2O3S2/c1-10(19-13(18)5-4-11-6-8-21-9-11)14-16-17-15(20-14)12-3-2-7-22-12/h2-10H,1H3/b5-4+/t10-/m1/s1 |
| InChIKey | XHSKCFVWAPNOIG-ORAHPGNNSA-N |
| XLogP | 4.18 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|