C13H15ClN8 — CID 7716257
1-butyl-5-[[5-(3-chlorophenyl)tetrazol-2-yl]methyl]tetrazole (PubChem CID 7716257) has the molecular formula C13H15ClN8 and a molecular weight of 318.77 g/mol. Its IUPAC name is 1-butyl-5-[[5-(3-chlorophenyl)tetrazol-2-yl]methyl]tetrazole.
| Compound Name | 1-butyl-5-[[5-(3-chlorophenyl)tetrazol-2-yl]methyl]tetrazole |
|---|---|
| PubChem CID | 7716257 |
| Molecular Formula | C13H15ClN8 |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-butyl-5-[[5-(3-chlorophenyl)tetrazol-2-yl]methyl]tetrazole |
| SMILES | CCCCn1nnnc1Cn1nnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C13H15ClN8/c1-2-3-7-21-12(15-18-20-21)9-22-17-13(16-19-22)10-5-4-6-11(14)8-10/h4-6,8H,2-3,7,9H2,1H3 |
| InChIKey | HEAAXIDRULURGE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |