C11H13ClN4O — CID 84759511
3-[5-[(3-chlorophenyl)methyl]tetrazol-1-yl]propan-1-ol (PubChem CID 84759511) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is 3-[5-[(3-chlorophenyl)methyl]tetrazol-1-yl]propan-1-ol.
| Compound Name | 3-[5-[(3-chlorophenyl)methyl]tetrazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 84759511 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-[5-[(3-chlorophenyl)methyl]tetrazol-1-yl]propan-1-ol |
| SMILES | OCCCn1nnnc1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN4O/c12-10-4-1-3-9(7-10)8-11-13-14-15-16(11)5-2-6-17/h1,3-4,7,17H,2,5-6,8H2 |
| InChIKey | OFKFCTVVCIEZSJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |