C15H22ClNO — CID 77164058
3-[1-(2-chloro-4-methylphenoxy)butyl]pyrrolidine (PubChem CID 77164058) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-methylphenoxy)butyl]pyrrolidine.
| Compound Name | 3-[1-(2-chloro-4-methylphenoxy)butyl]pyrrolidine |
|---|---|
| PubChem CID | 77164058 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[1-(2-chloro-4-methylphenoxy)butyl]pyrrolidine |
| SMILES | CCCC(Oc1ccc(C)cc1Cl)C1CCNC1 |
| InChI | InChI=1S/C15H22ClNO/c1-3-4-14(12-7-8-17-10-12)18-15-6-5-11(2)9-13(15)16/h5-6,9,12,14,17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JXKANAIWRRHWJC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |