C14H18F3NO — CID 66892006
(3S)-3-[(1R)-1-(2,3,4-trifluorophenoxy)butyl]pyrrolidine (PubChem CID 66892006) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-(2,3,4-trifluorophenoxy)butyl]pyrrolidine.
| Compound Name | (3S)-3-[(1R)-1-(2,3,4-trifluorophenoxy)butyl]pyrrolidine |
|---|---|
| PubChem CID | 66892006 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3S)-3-[(1R)-1-(2,3,4-trifluorophenoxy)butyl]pyrrolidine |
| SMILES | CCC[C@@H](Oc1ccc(F)c(F)c1F)[C@H]1CCNC1 |
| InChI | InChI=1S/C14H18F3NO/c1-2-3-11(9-6-7-18-8-9)19-12-5-4-10(15)13(16)14(12)17/h4-5,9,11,18H,2-3,6-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | QNIBRBVWHUIJBE-GXSJLCMTSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|