C20H18N2O7 — CID 7716595
[(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7716595) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7716595 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)[C@H](C)OC(=O)/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)c1 |
| InChI | InChI=1S/C20H18N2O7/c1-12-4-3-5-15(8-12)21-20(24)13(2)29-19(23)7-6-14-9-17-18(28-11-27-17)10-16(14)22(25)26/h3-10,13H,11H2,1-2H3,(H,21,24)/b7-6+/t13-/m0/s1 |
| InChIKey | SIQOXQCEAODFLJ-YBJDMEARSA-N |
| XLogP | 3.22 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|