2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate

C22H16Cl2O4 — CID 7716784

IUPAC2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate
SMILESO=C(OCCOc1c(Cl)cccc1Cl)C1c2ccccc2Oc2ccccc21
InChIInChI=1S/C22H16Cl2O4/c23-16-8-5-9-17(24)21(16)26-12-13-27-22(25)20-14-6-1-3-10-18(14)28-19-11-4-2-7-15(19)20/h1-11,20H,12-13H2
InChIKeyKITGOJRBVATMKX-UHFFFAOYSA-N
MW415.27 g/mol
LogP5.85
Rot. Bonds5

About 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate

2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate (PubChem CID 7716784) has the molecular formula C22H16Cl2O4 and a molecular weight of 415.27 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate.

Molecular Properties

Compound Name2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate
PubChem CID7716784
Molecular FormulaC22H16Cl2O4
Molecular Weight415.27 g/mol
Exact Mass414.04
IUPAC Name2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate
SMILESO=C(OCCOc1c(Cl)cccc1Cl)C1c2ccccc2Oc2ccccc21
InChIInChI=1S/C22H16Cl2O4/c23-16-8-5-9-17(24)21(16)26-12-13-27-22(25)20-14-6-1-3-10-18(14)28-19-11-4-2-7-15(19)20/h1-11,20H,12-13H2
InChIKeyKITGOJRBVATMKX-UHFFFAOYSA-N
XLogP5.85
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500415.27
LogP ≤ 55.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate?
The IUPAC name of 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate (CID 7716784) is 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate.
What is the SMILES notation for 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate?
The canonical SMILES for 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate is O=C(OCCOc1c(Cl)cccc1Cl)C1c2ccccc2Oc2ccccc21.
What is the InChIKey of 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate?
The InChIKey is KITGOJRBVATMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2O4/c23-16-8-5-9-17(24)21(16)26-12-13-27-22(25)20-14-6-1-3-10-18(14)28-19-11-4-2-7-15(19)20/h1-11,20H,12-13H2.
What are the key properties of 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate?
2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate has a molecular weight of 415.27 g/mol, XLogP of 5.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate is sourced from PubChem (CID 7716784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).