C22H16Cl2O4 — CID 7716784
2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate (PubChem CID 7716784) has the molecular formula C22H16Cl2O4 and a molecular weight of 415.27 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 7716784 |
| Molecular Formula | C22H16Cl2O4 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 9H-xanthene-9-carboxylate |
| SMILES | O=C(OCCOc1c(Cl)cccc1Cl)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C22H16Cl2O4/c23-16-8-5-9-17(24)21(16)26-12-13-27-22(25)20-14-6-1-3-10-18(14)28-19-11-4-2-7-15(19)20/h1-11,20H,12-13H2 |
| InChIKey | KITGOJRBVATMKX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|