C23H20F4N4O2S — CID 77181463
6-(3-cyano-1-cyclohex-2-en-1-yl-5-fluoroindol-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide (PubChem CID 77181463) has the molecular formula C23H20F4N4O2S and a molecular weight of 492.50 g/mol. Its IUPAC name is 6-(3-cyano-1-cyclohex-2-en-1-yl-5-fluoroindol-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(3-cyano-1-cyclohex-2-en-1-yl-5-fluoroindol-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 77181463 |
| Molecular Formula | C23H20F4N4O2S |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 6-(3-cyano-1-cyclohex-2-en-1-yl-5-fluoroindol-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(-c2c(C#N)c3cc(F)ccc3n2C2C=CCCC2)nc1)C(F)(F)F |
| InChI | InChI=1S/C23H20F4N4O2S/c1-14(23(25,26)27)30-34(32,33)17-8-9-20(29-13-17)22-19(12-28)18-11-15(24)7-10-21(18)31(22)16-5-3-2-4-6-16/h3,5,7-11,13-14,16,30H,2,4,6H2,1H3 |
| InChIKey | AHUREBGJXVLJRX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|