C34H59NO2 — CID 77184725
2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-(2-methylbutyl)acetamide (PubChem CID 77184725) has the molecular formula C34H59NO2 and a molecular weight of 513.85 g/mol. Its IUPAC name is 2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-(2-methylbutyl)acetamide.
| Compound Name | 2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-(2-methylbutyl)acetamide |
|---|---|
| PubChem CID | 77184725 |
| Molecular Formula | C34H59NO2 |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 513.45 |
| IUPAC Name | 2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-N-(2-methylbutyl)acetamide |
| SMILES | CCC(C)CNC(=O)COC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C34H59NO2/c1-8-24(4)21-35-32(36)22-37-27-16-18-33(6)26(20-27)12-13-28-30-15-14-29(25(5)11-9-10-23(2)3)34(30,7)19-17-31(28)33/h12,23-25,27-31H,8-11,13-22H2,1-7H3,(H,35,36) |
| InChIKey | SOJSZWWDFADLRW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|