C31H41ClN4O4 — CID 77191030
tert-butyl N-[1-(4-chlorophenyl)-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate (PubChem CID 77191030) has the molecular formula C31H41ClN4O4 and a molecular weight of 569.15 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chlorophenyl)-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chlorophenyl)-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 77191030 |
| Molecular Formula | C31H41ClN4O4 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | tert-butyl N-[1-(4-chlorophenyl)-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutan-2-yl]carbamate |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(Cc3ccc(Cl)cc3)NC(=O)OC(C)(C)C)C2)nc2ccccc21 |
| InChI | InChI=1S/C31H41ClN4O4/c1-31(2,3)40-30(38)33-25(19-22-12-14-24(32)15-13-22)20-28(37)35-16-7-9-23(21-35)29-34-26-10-5-6-11-27(26)36(29)17-8-18-39-4/h5-6,10-15,23,25H,7-9,16-21H2,1-4H3,(H,33,38) |
| InChIKey | SECFYSLNFBCNJW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|