C13H20F3NO2 — CID 77211822
[2-(hydroxymethyl)pyrrolidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 77211822) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 77211822 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [2-(hydroxymethyl)pyrrolidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | O=C(C1CCC(C(F)(F)F)CC1)N1CCCC1CO |
| InChI | InChI=1S/C13H20F3NO2/c14-13(15,16)10-5-3-9(4-6-10)12(19)17-7-1-2-11(17)8-18/h9-11,18H,1-8H2 |
| InChIKey | UJWVHGGMORRRCD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |