C11H17NO5 — CID 77218696
4-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 77218696) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 77218696 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CCOC(=O)C=CC1COC(C)(C)N1C(=O)O |
| InChI | InChI=1S/C11H17NO5/c1-4-16-9(13)6-5-8-7-17-11(2,3)12(8)10(14)15/h5-6,8H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | AGQXWIGQCHSJSU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|