C6H10N4O — CID 77230979
3-amino-N,1-dimethylpyrazole-5-carboxamide (PubChem CID 77230979) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-amino-N,1-dimethylpyrazole-5-carboxamide.
| Compound Name | 3-amino-N,1-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 77230979 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 3-amino-N,1-dimethylpyrazole-5-carboxamide |
| SMILES | CNC(=O)c1cc(N)nn1C |
| InChI | InChI=1S/C6H10N4O/c1-8-6(11)4-3-5(7)9-10(4)2/h3H,1-2H3,(H2,7,9)(H,8,11) |
| InChIKey | BXDJHWXXWQJSGH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |