C16H17Cl2N3O3S — CID 77243791
N-[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]pyridine-3-sulfonamide (PubChem CID 77243791) has the molecular formula C16H17Cl2N3O3S and a molecular weight of 402.30 g/mol. Its IUPAC name is N-[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]pyridine-3-sulfonamide.
| Compound Name | N-[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 77243791 |
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CNCCOC1c1ccc(Cl)c(Cl)c1)c1cccnc1 |
| InChI | InChI=1S/C16H17Cl2N3O3S/c17-13-4-3-11(8-14(13)18)16-15(10-20-6-7-24-16)21-25(22,23)12-2-1-5-19-9-12/h1-5,8-9,15-16,20-21H,6-7,10H2 |
| InChIKey | HACKAWYVBSYKLC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |