C25H30N2O4 — CID 77263105
methyl 5-hydroxy-5-phenyl-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxylate (PubChem CID 77263105) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is methyl 5-hydroxy-5-phenyl-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 5-hydroxy-5-phenyl-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 77263105 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | methyl 5-hydroxy-5-phenyl-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(O)(c2ccccc2)CCC1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N2O4/c1-31-24(29)22-18-25(30,19-8-4-2-5-9-19)13-12-21(22)23(28)27-16-14-26(15-17-27)20-10-6-3-7-11-20/h2-11,21-22,30H,12-18H2,1H3 |
| InChIKey | MCVXPBLTXUQGBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |