C18H22N2O5S — CID 7728208
(4-methylphenyl) (3S)-3-(furan-2-ylmethylcarbamoyl)piperidine-1-sulfonate (PubChem CID 7728208) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is (4-methylphenyl) (3S)-3-(furan-2-ylmethylcarbamoyl)piperidine-1-sulfonate.
| Compound Name | (4-methylphenyl) (3S)-3-(furan-2-ylmethylcarbamoyl)piperidine-1-sulfonate |
|---|---|
| PubChem CID | 7728208 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (4-methylphenyl) (3S)-3-(furan-2-ylmethylcarbamoyl)piperidine-1-sulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)N2CCC[C@H](C(=O)NCc3ccco3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-14-6-8-16(9-7-14)25-26(22,23)20-10-2-4-15(13-20)18(21)19-12-17-5-3-11-24-17/h3,5-9,11,15H,2,4,10,12-13H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | LCJUTHWAAPXGDP-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |