C15H21NO4S — CID 77288604
(4-ethylsulfanyl-1-methoxy-1-oxo-5-phenylpentan-2-yl)carbamic acid (PubChem CID 77288604) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (4-ethylsulfanyl-1-methoxy-1-oxo-5-phenylpentan-2-yl)carbamic acid.
| Compound Name | (4-ethylsulfanyl-1-methoxy-1-oxo-5-phenylpentan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 77288604 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (4-ethylsulfanyl-1-methoxy-1-oxo-5-phenylpentan-2-yl)carbamic acid |
| SMILES | CCSC(Cc1ccccc1)CC(NC(=O)O)C(=O)OC |
| InChI | InChI=1S/C15H21NO4S/c1-3-21-12(9-11-7-5-4-6-8-11)10-13(14(17)20-2)16-15(18)19/h4-8,12-13,16H,3,9-10H2,1-2H3,(H,18,19) |
| InChIKey | GJOXAVDQGIVSIQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |