C23H37NO5S — CID 67419025
[(4R)-4-decylsulfinyl-1-methoxy-1-oxo-5-phenylpentan-2-yl]carbamic acid (PubChem CID 67419025) has the molecular formula C23H37NO5S and a molecular weight of 439.62 g/mol. Its IUPAC name is [(4R)-4-decylsulfinyl-1-methoxy-1-oxo-5-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(4R)-4-decylsulfinyl-1-methoxy-1-oxo-5-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67419025 |
| Molecular Formula | C23H37NO5S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [(4R)-4-decylsulfinyl-1-methoxy-1-oxo-5-phenylpentan-2-yl]carbamic acid |
| SMILES | CCCCCCCCCCS(=O)[C@H](Cc1ccccc1)CC(NC(=O)O)C(=O)OC |
| InChI | InChI=1S/C23H37NO5S/c1-3-4-5-6-7-8-9-13-16-30(28)20(17-19-14-11-10-12-15-19)18-21(22(25)29-2)24-23(26)27/h10-12,14-15,20-21,24H,3-9,13,16-18H2,1-2H3,(H,26,27)/t20-,21?,30?/m1/s1 |
| InChIKey | XKBKWXIIZKVQIR-YNMNPJMFSA-N |
| XLogP | 4.69 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|