C20H21F3N2O2S — CID 7729755
(2R)-2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 7729755) has the molecular formula C20H21F3N2O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is (2R)-2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 7729755 |
| Molecular Formula | C20H21F3N2O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (2R)-2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCc1ccc(NC(=O)CS[C@H](C)C(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O2S/c1-3-14-8-10-15(11-9-14)24-18(26)12-28-13(2)19(27)25-17-7-5-4-6-16(17)20(21,22)23/h4-11,13H,3,12H2,1-2H3,(H,24,26)(H,25,27)/t13-/m1/s1 |
| InChIKey | SEOBBGLZBNAUAP-CYBMUJFWSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |