C20H23ClN2O4S — CID 7730491
(2S)-N-(3-chloro-4-methoxyphenyl)-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylpropanamide (PubChem CID 7730491) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-methoxyphenyl)-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylpropanamide.
| Compound Name | (2S)-N-(3-chloro-4-methoxyphenyl)-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7730491 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2S)-N-(3-chloro-4-methoxyphenyl)-2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanylpropanamide |
| SMILES | CCOc1ccc(NC(=O)CS[C@@H](C)C(=O)Nc2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23ClN2O4S/c1-4-27-16-8-5-14(6-9-16)22-19(24)12-28-13(2)20(25)23-15-7-10-18(26-3)17(21)11-15/h5-11,13H,4,12H2,1-3H3,(H,22,24)(H,23,25)/t13-/m0/s1 |
| InChIKey | HAFYBQHWRPFBPH-ZDUSSCGKSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |