C22H20N2O4 — CID 7731874
ethyl 3-oxo-2-(2-oxopropyl)-5,6-diphenylpyridazine-4-carboxylate (PubChem CID 7731874) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl 3-oxo-2-(2-oxopropyl)-5,6-diphenylpyridazine-4-carboxylate.
| Compound Name | ethyl 3-oxo-2-(2-oxopropyl)-5,6-diphenylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 7731874 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl 3-oxo-2-(2-oxopropyl)-5,6-diphenylpyridazine-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(-c2ccccc2)nn(CC(C)=O)c1=O |
| InChI | InChI=1S/C22H20N2O4/c1-3-28-22(27)19-18(16-10-6-4-7-11-16)20(17-12-8-5-9-13-17)23-24(21(19)26)14-15(2)25/h4-13H,3,14H2,1-2H3 |
| InChIKey | NCHRKQVREJJQJH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |