C27H20Cl2N2O4 — CID 54510230
ethyl 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]benzoate (PubChem CID 54510230) has the molecular formula C27H20Cl2N2O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is ethyl 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]benzoate.
| Compound Name | ethyl 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]benzoate |
|---|---|
| PubChem CID | 54510230 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | ethyl 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-n1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c(C(C)=O)c1=O |
| InChI | InChI=1S/C27H20Cl2N2O4/c1-3-35-27(34)21-6-4-5-7-22(21)31-26(33)23(16(2)32)24(17-8-12-19(28)13-9-17)25(30-31)18-10-14-20(29)15-11-18/h4-15H,3H2,1-2H3 |
| InChIKey | YIOQRTNHTKKETO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |